(5-Bromo-2-chloro-3-pyridinyl)methanol
Catalog No: FT-0678309
CAS No: 742100-75-0
- Chemical Name: (5-Bromo-2-chloro-3-pyridinyl)methanol
- Molecular Formula: C6H5BrClNO
- Molecular Weight: 222.47
- InChI Key: ZZGSPGXWLOYKFH-UHFFFAOYSA-N
- InChI: InChI=1S/C6H5BrClNO/c7-5-1-4(3-10)6(8)9-2-5/h1-2,10H,3H2
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Danger |
|---|---|
| FW: | 222.467 |
| Density: | 1.8±0.1 g/cm3 |
| CAS: | 742100-75-0 |
| Bolling_Point: | 320.5±37.0 °C at 760 mmHg |
| Product_Name: | (5-Bromo-2-chloro-3-pyridinyl)methanol |
| Melting_Point: | 76-78ºC |
| Flash_Point: | 147.6±26.5 °C |
| MF: | C6H5BrClNO |
| Density: | 1.8±0.1 g/cm3 |
|---|---|
| LogP: | 1.18 |
| Flash_Point: | 147.6±26.5 °C |
| Melting_Point: | 76-78ºC |
| FW: | 222.467 |
| PSA: | 33.12000 |
| Exact_Mass: | 220.924301 |
| MF: | C6H5BrClNO |
| Bolling_Point: | 320.5±37.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±0.7 mmHg at 25°C |
| Refractive_Index: | 1.613 |
| Hazard_Codes: | Xi: Irritant; |
|---|---|
| Warning_Statement: | P280-P301 + P312 + P330-P304 + P340 + P312-P305 + P351 + P338 + P310 |
| Safety_Statements: | H302-H315-H318-H335 |
| Symbol: | Danger |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933399090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)